About 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one
4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one (PubChem CID 10870008) has the molecular formula C20H18O2
and a molecular weight of 290.36 g/mol. Its IUPAC name is 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one.
Molecular Properties
| Compound Name | 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one |
| PubChem CID | 10870008 |
| Molecular Formula | C20H18O2 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.13 |
| IUPAC Name | 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one |
| SMILES | COC1=CCCC(=O)C(c2ccccc2)=C1c1ccccc1 |
| InChI | InChI=1S/C20H18O2/c1-22-18-14-8-13-17(21)19(15-9-4-2-5-10-15)20(18)16-11-6-3-7-12-16/h2-7,9-12,14H,8,13H2,1H3 |
| InChIKey | ZAKYIOCZBKKRTC-UHFFFAOYSA-N |
| XLogP | 4.49 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 4.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|
Analyze 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one?
The IUPAC name of 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one (CID 10870008) is 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one.
What is the SMILES notation for 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one?
The canonical SMILES for 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one is COC1=CCCC(=O)C(c2ccccc2)=C1c1ccccc1.
What is the InChIKey of 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one?
The InChIKey is ZAKYIOCZBKKRTC-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H18O2/c1-22-18-14-8-13-17(21)19(15-9-4-2-5-10-15)20(18)16-11-6-3-7-12-16/h2-7,9-12,14H,8,13H2,1H3.
What are the key properties of 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one?
4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one has a molecular weight of 290.36 g/mol, XLogP of 4.49, 3 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-methoxy-2,3-diphenylcyclohepta-2,4-dien-1-one is sourced from PubChem (CID 10870008), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).