C25H18ClFN2O7 — CID 108700952
(4E)-1-(3-chloro-4-fluorophenyl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108700952) has the molecular formula C25H18ClFN2O7 and a molecular weight of 512.88 g/mol. Its IUPAC name is (4E)-1-(3-chloro-4-fluorophenyl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(3-chloro-4-fluorophenyl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108700952 |
| Molecular Formula | C25H18ClFN2O7 |
| Molecular Weight | 512.88 g/mol |
| Exact Mass | 512.08 |
| IUPAC Name | (4E)-1-(3-chloro-4-fluorophenyl)-5-(3,4-dimethoxyphenyl)-4-[hydroxy-(4-nitrophenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3ccc([N+](=O)[O-])cc3)C(=O)C(=O)N2c2ccc(F)c(Cl)c2)cc1OC |
| InChI | InChI=1S/C25H18ClFN2O7/c1-35-19-10-5-14(11-20(19)36-2)22-21(23(30)13-3-6-15(7-4-13)29(33)34)24(31)25(32)28(22)16-8-9-18(27)17(26)12-16/h3-12,22,30H,1-2H3/b23-21+ |
| InChIKey | PFVXNNYLWFFVLB-XTQSDGFTSA-N |
| XLogP | 5.03 |
| TPSA | 119.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.88 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|