About methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate (PubChem CID 10870150) has the molecular formula C17H13NO4
and a molecular weight of 295.29 g/mol. Its IUPAC name is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate.
Molecular Properties
| Compound Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate |
| PubChem CID | 10870150 |
| Molecular Formula | C17H13NO4 |
| Molecular Weight | 295.29 g/mol |
| Exact Mass | 295.08 |
| IUPAC Name | methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate |
| SMILES | COC(=O)[C@H](c1ccccc1)N1C(=O)c2ccccc2C1=O |
| InChI | InChI=1S/C17H13NO4/c1-22-17(21)14(11-7-3-2-4-8-11)18-15(19)12-9-5-6-10-13(12)16(18)20/h2-10,14H,1H3/t14-/m0/s1 |
| InChIKey | HGVNXDWPGGUXDY-AWEZNQCLSA-N |
| XLogP | 2.20 |
| TPSA | 63.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 295.29 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate?
The IUPAC name of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate (CID 10870150) is methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate.
What is the SMILES notation for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate?
The canonical SMILES for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate is COC(=O)[C@H](c1ccccc1)N1C(=O)c2ccccc2C1=O.
What is the InChIKey of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate?
The InChIKey is HGVNXDWPGGUXDY-AWEZNQCLSA-N. The full InChI is InChI=1S/C17H13NO4/c1-22-17(21)14(11-7-3-2-4-8-11)18-15(19)12-9-5-6-10-13(12)16(18)20/h2-10,14H,1H3/t14-/m0/s1.
What are the key properties of methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate?
methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate has a molecular weight of 295.29 g/mol, XLogP of 2.20, 3 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for methyl (2S)-2-(1,3-dioxoisoindol-2-yl)-2-phenylacetate is sourced from PubChem (CID 10870150), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).