C27H24Cl2N2O7 — CID 108702565
(4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-4-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108702565) has the molecular formula C27H24Cl2N2O7 and a molecular weight of 559.40 g/mol. Its IUPAC name is (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-4-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-4-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108702565 |
| Molecular Formula | C27H24Cl2N2O7 |
| Molecular Weight | 559.40 g/mol |
| Exact Mass | 558.10 |
| IUPAC Name | (4E)-4-[(3,5-dichloro-4-methoxyphenyl)-hydroxymethylidene]-1-(pyridin-4-ylmethyl)-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(C2/C(=C(\O)c3cc(Cl)c(OC)c(Cl)c3)C(=O)C(=O)N2Cc2ccncc2)cc(OC)c1OC |
| InChI | InChI=1S/C27H24Cl2N2O7/c1-35-19-11-15(12-20(36-2)26(19)38-4)22-21(23(32)16-9-17(28)25(37-3)18(29)10-16)24(33)27(34)31(22)13-14-5-7-30-8-6-14/h5-12,22,32H,13H2,1-4H3/b23-21+ |
| InChIKey | RJAMDIXARWJXPJ-XTQSDGFTSA-N |
| XLogP | 5.04 |
| TPSA | 107.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 559.40 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|