C31H42N2O7 — CID 108702617
(4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108702617) has the molecular formula C31H42N2O7 and a molecular weight of 554.68 g/mol. Its IUPAC name is (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108702617 |
| Molecular Formula | C31H42N2O7 |
| Molecular Weight | 554.68 g/mol |
| Exact Mass | 554.30 |
| IUPAC Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-[3-(dimethylamino)propyl]-5-(3,4,5-trimethoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(CCCN(C)C)C2c2cc(OC)c(OC)c(OC)c2)cc1C(C)(C)C |
| InChI | InChI=1S/C31H42N2O7/c1-10-40-22-13-12-19(16-21(22)31(2,3)4)27(34)25-26(33(30(36)28(25)35)15-11-14-32(5)6)20-17-23(37-7)29(39-9)24(18-20)38-8/h12-13,16-18,26,34H,10-11,14-15H2,1-9H3/b27-25+ |
| InChIKey | DPKXWUVAPUCAAG-IMVLJIQESA-N |
| XLogP | 4.78 |
| TPSA | 97.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.68 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|