C31H33NO6 — CID 108703240
(4Z)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-(2-methoxyethyl)-5-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidine-2,3-dione (PubChem CID 108703240) has the molecular formula C31H33NO6 and a molecular weight of 515.61 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-(2-methoxyethyl)-5-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-(2-methoxyethyl)-5-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108703240 |
| Molecular Formula | C31H33NO6 |
| Molecular Weight | 515.61 g/mol |
| Exact Mass | 515.23 |
| IUPAC Name | (4Z)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-1-(2-methoxyethyl)-5-[4-[(2-methylphenyl)methoxy]phenyl]pyrrolidine-2,3-dione |
| SMILES | COCCN1C(=O)C(=O)/C(=C(\O)c2cccc(OC(C)C)c2)C1c1ccc(OCc2ccccc2C)cc1 |
| InChI | InChI=1S/C31H33NO6/c1-20(2)38-26-11-7-10-23(18-26)29(33)27-28(32(16-17-36-4)31(35)30(27)34)22-12-14-25(15-13-22)37-19-24-9-6-5-8-21(24)3/h5-15,18,20,28,33H,16-17,19H2,1-4H3/b29-27- |
| InChIKey | KFJWFZISIBAPKA-OHYPFYFLSA-N |
| XLogP | 5.43 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 515.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|