About 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one
5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one (PubChem CID 10870364) has the molecular formula C14H20ClNO4
and a molecular weight of 301.77 g/mol. Its IUPAC name is 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one.
Molecular Properties
| Compound Name | 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one |
| PubChem CID | 10870364 |
| Molecular Formula | C14H20ClNO4 |
| Molecular Weight | 301.77 g/mol |
| Exact Mass | 301.11 |
| IUPAC Name | 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one |
| SMILES | C=CCC1(Cl)C(=O)C=C(N2CCOCC2)C1(OC)OC |
| InChI | InChI=1S/C14H20ClNO4/c1-4-5-13(15)12(17)10-11(14(13,18-2)19-3)16-6-8-20-9-7-16/h4,10H,1,5-9H2,2-3H3 |
| InChIKey | YMSZWCQYKDXTSK-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 48.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.77 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one?
The IUPAC name of 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one (CID 10870364) is 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one.
What is the SMILES notation for 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one?
The canonical SMILES for 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one is C=CCC1(Cl)C(=O)C=C(N2CCOCC2)C1(OC)OC.
What is the InChIKey of 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one?
The InChIKey is YMSZWCQYKDXTSK-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H20ClNO4/c1-4-5-13(15)12(17)10-11(14(13,18-2)19-3)16-6-8-20-9-7-16/h4,10H,1,5-9H2,2-3H3.
What are the key properties of 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one?
5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one has a molecular weight of 301.77 g/mol, XLogP of 1.33, 5 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 5-chloro-4,4-dimethoxy-3-morpholin-4-yl-5-prop-2-enylcyclopent-2-en-1-one is sourced from PubChem (CID 10870364), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).