C30H30ClNO6 — CID 108703758
(4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)-1-(4-ethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108703758) has the molecular formula C30H30ClNO6 and a molecular weight of 536.02 g/mol. Its IUPAC name is (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)-1-(4-ethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108703758 |
| Molecular Formula | C30H30ClNO6 |
| Molecular Weight | 536.02 g/mol |
| Exact Mass | 535.18 |
| IUPAC Name | (4E)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)-1-(4-ethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(CC)cc3)C2c2ccc(OC)c(OCC)c2)c1 |
| InChI | InChI=1S/C30H30ClNO6/c1-5-18-8-11-20(12-9-18)32-27(19-10-15-24(36-4)25(16-19)38-7-3)26(29(34)30(32)35)28(33)22-17-21(37-6-2)13-14-23(22)31/h8-17,27,33H,5-7H2,1-4H3/b28-26+ |
| InChIKey | XPRKCZVASWBRQC-BYCLXTJYSA-N |
| XLogP | 6.33 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.02 |
| LogP ≤ 5 | 6.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|