C31H33NO7 — CID 108704424
(4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108704424) has the molecular formula C31H33NO7 and a molecular weight of 531.61 g/mol. Its IUPAC name is (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108704424 |
| Molecular Formula | C31H33NO7 |
| Molecular Weight | 531.61 g/mol |
| Exact Mass | 531.23 |
| IUPAC Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-methyl-4-propoxyphenyl)methylidene]-1-(2-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccccc3OC)C2c2ccc(OC)c(OCC)c2)cc1C |
| InChI | InChI=1S/C31H33NO7/c1-6-16-39-23-14-13-21(17-19(23)3)29(33)27-28(20-12-15-25(37-5)26(18-20)38-7-2)32(31(35)30(27)34)22-10-8-9-11-24(22)36-4/h8-15,17-18,28,33H,6-7,16H2,1-5H3/b29-27- |
| InChIKey | FXKAULVZXYDCAE-OHYPFYFLSA-N |
| XLogP | 5.83 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.61 |
| LogP ≤ 5 | 5.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|