C29H37NO7 — CID 108704890
(4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione (PubChem CID 108704890) has the molecular formula C29H37NO7 and a molecular weight of 511.62 g/mol. Its IUPAC name is (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108704890 |
| Molecular Formula | C29H37NO7 |
| Molecular Weight | 511.62 g/mol |
| Exact Mass | 511.26 |
| IUPAC Name | (4Z)-5-(3-ethoxy-4-methoxyphenyl)-4-[hydroxy-(3-propoxyphenyl)methylidene]-1-(3-propan-2-yloxypropyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(/C(O)=C2/C(=O)C(=O)N(CCCOC(C)C)C2c2ccc(OC)c(OCC)c2)c1 |
| InChI | InChI=1S/C29H37NO7/c1-6-15-37-22-11-8-10-21(17-22)27(31)25-26(20-12-13-23(34-5)24(18-20)35-7-2)30(29(33)28(25)32)14-9-16-36-19(3)4/h8,10-13,17-19,26,31H,6-7,9,14-16H2,1-5H3/b27-25- |
| InChIKey | YFMOMSNBTMTAPZ-RFBIWTDZSA-N |
| XLogP | 5.12 |
| TPSA | 94.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 511.62 |
| LogP ≤ 5 | 5.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|