C28H24ClN3O6 — CID 108705051
(4E)-1-(1H-benzimidazol-2-yl)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108705051) has the molecular formula C28H24ClN3O6 and a molecular weight of 533.97 g/mol. Its IUPAC name is (4E)-1-(1H-benzimidazol-2-yl)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108705051 |
| Molecular Formula | C28H24ClN3O6 |
| Molecular Weight | 533.97 g/mol |
| Exact Mass | 533.14 |
| IUPAC Name | (4E)-1-(1H-benzimidazol-2-yl)-4-[(5-chloro-2-methoxyphenyl)-hydroxymethylidene]-5-(3-ethoxy-4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1cc(C2/C(=C(\O)c3cc(Cl)ccc3OC)C(=O)C(=O)N2c2nc3ccccc3[nH]2)ccc1OC |
| InChI | InChI=1S/C28H24ClN3O6/c1-4-38-22-13-15(9-11-21(22)37-3)24-23(25(33)17-14-16(29)10-12-20(17)36-2)26(34)27(35)32(24)28-30-18-7-5-6-8-19(18)31-28/h5-14,24,33H,4H2,1-3H3,(H,30,31)/b25-23+ |
| InChIKey | MTYCLPTUILKGMC-WJTDDFOZSA-N |
| XLogP | 5.26 |
| TPSA | 113.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 533.97 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|