About 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole
1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole (PubChem CID 10870596) has the molecular formula C18H16ClN3
and a molecular weight of 309.80 g/mol. Its IUPAC name is 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole.
Molecular Properties
| Compound Name | 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole |
| PubChem CID | 10870596 |
| Molecular Formula | C18H16ClN3 |
| Molecular Weight | 309.80 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole |
| SMILES | Cc1cc2n(n1)CC(c1ccccc1)N2c1ccc(Cl)cc1 |
| InChI | InChI=1S/C18H16ClN3/c1-13-11-18-21(20-13)12-17(14-5-3-2-4-6-14)22(18)16-9-7-15(19)8-10-16/h2-11,17H,12H2,1H3 |
| InChIKey | UBOISEVUMWLTHZ-UHFFFAOYSA-N |
| XLogP | 4.74 |
| TPSA | 21.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.80 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole?
The IUPAC name of 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole (CID 10870596) is 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole.
What is the SMILES notation for 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole?
The canonical SMILES for 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole is Cc1cc2n(n1)CC(c1ccccc1)N2c1ccc(Cl)cc1.
What is the InChIKey of 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole?
The InChIKey is UBOISEVUMWLTHZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H16ClN3/c1-13-11-18-21(20-13)12-17(14-5-3-2-4-6-14)22(18)16-9-7-15(19)8-10-16/h2-11,17H,12H2,1H3.
What are the key properties of 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole?
1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole has a molecular weight of 309.80 g/mol, XLogP of 4.74, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(4-chlorophenyl)-6-methyl-2-phenyl-2,3-dihydroimidazo[1,2-b]pyrazole is sourced from PubChem (CID 10870596), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).