C15H23NO6 — CID 10870707
tert-butyl 5,5-bis(acetyloxymethyl)-2H-pyrrole-1-carboxylate (PubChem CID 10870707) has the molecular formula C15H23NO6 and a molecular weight of 313.35 g/mol. Its IUPAC name is tert-butyl 5,5-bis(acetyloxymethyl)-2H-pyrrole-1-carboxylate.
| Compound Name | tert-butyl 5,5-bis(acetyloxymethyl)-2H-pyrrole-1-carboxylate |
|---|---|
| PubChem CID | 10870707 |
| Molecular Formula | C15H23NO6 |
| Molecular Weight | 313.35 g/mol |
| Exact Mass | 313.15 |
| IUPAC Name | tert-butyl 5,5-bis(acetyloxymethyl)-2H-pyrrole-1-carboxylate |
| SMILES | CC(=O)OCC1(COC(C)=O)C=CCN1C(=O)OC(C)(C)C |
| InChI | InChI=1S/C15H23NO6/c1-11(17)20-9-15(10-21-12(2)18)7-6-8-16(15)13(19)22-14(3,4)5/h6-7H,8-10H2,1-5H3 |
| InChIKey | VAEOWFJUBHGBBY-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 82.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.35 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|