C33H36N4O3 — CID 108707533
(4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(5,6-dimethyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione (PubChem CID 108707533) has the molecular formula C33H36N4O3 and a molecular weight of 536.68 g/mol. Its IUPAC name is (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(5,6-dimethyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(5,6-dimethyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108707533 |
| Molecular Formula | C33H36N4O3 |
| Molecular Weight | 536.68 g/mol |
| Exact Mass | 536.28 |
| IUPAC Name | (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(5,6-dimethyl-1H-benzimidazol-2-yl)pyrrolidine-2,3-dione |
| SMILES | Cc1cc2nc(N3C(=O)C(=O)/C(=C(/O)c4cc(C(C)(C)C)ccc4C)C3c3ccc(N(C)C)cc3)[nH]c2cc1C |
| InChI | InChI=1S/C33H36N4O3/c1-18-9-12-22(33(4,5)6)17-24(18)29(38)27-28(21-10-13-23(14-11-21)36(7)8)37(31(40)30(27)39)32-34-25-15-19(2)20(3)16-26(25)35-32/h9-17,28,38H,1-8H3,(H,34,35)/b29-27+ |
| InChIKey | UMHKLTOJCHJGES-ORIPQNMZSA-N |
| XLogP | 6.48 |
| TPSA | 89.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.68 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|