About tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate
tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate (PubChem CID 10870772) has the molecular formula C16H20F3NO2
and a molecular weight of 315.34 g/mol. Its IUPAC name is tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate.
Molecular Properties
| Compound Name | tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate |
| PubChem CID | 10870772 |
| Molecular Formula | C16H20F3NO2 |
| Molecular Weight | 315.34 g/mol |
| Exact Mass | 315.14 |
| IUPAC Name | tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate |
| SMILES | CN(C)c1ccc(/C(=C\C(=O)OC(C)(C)C)C(F)(F)F)cc1 |
| InChI | InChI=1S/C16H20F3NO2/c1-15(2,3)22-14(21)10-13(16(17,18)19)11-6-8-12(9-7-11)20(4)5/h6-10H,1-5H3/b13-10+ |
| InChIKey | VWEKTVHXUFYORV-JLHYYAGUSA-N |
| XLogP | 4.04 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 315.34 |
| LogP ≤ 5 | 4.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate?
The IUPAC name of tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate (CID 10870772) is tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate.
What is the SMILES notation for tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate?
The canonical SMILES for tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate is CN(C)c1ccc(/C(=C\C(=O)OC(C)(C)C)C(F)(F)F)cc1.
What is the InChIKey of tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate?
The InChIKey is VWEKTVHXUFYORV-JLHYYAGUSA-N. The full InChI is InChI=1S/C16H20F3NO2/c1-15(2,3)22-14(21)10-13(16(17,18)19)11-6-8-12(9-7-11)20(4)5/h6-10H,1-5H3/b13-10+.
What are the key properties of tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate?
tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate has a molecular weight of 315.34 g/mol, XLogP of 4.04, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for tert-butyl (E)-3-[4-(dimethylamino)phenyl]-4,4,4-trifluorobut-2-enoate is sourced from PubChem (CID 10870772), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).