C21H33NO — CID 10870786
(2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-propan-2-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine (PubChem CID 10870786) has the molecular formula C21H33NO and a molecular weight of 315.50 g/mol. Its IUPAC name is (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-propan-2-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine.
| Compound Name | (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-propan-2-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
|---|---|
| PubChem CID | 10870786 |
| Molecular Formula | C21H33NO |
| Molecular Weight | 315.50 g/mol |
| Exact Mass | 315.26 |
| IUPAC Name | (2S,4aS,7R,8aR)-3-benzyl-4,4,7-trimethyl-2-propan-2-yl-4a,5,6,7,8,8a-hexahydro-2H-benzo[e][1,3]oxazine |
| SMILES | CC(C)[C@@H]1O[C@@H]2C[C@H](C)CC[C@H]2C(C)(C)N1Cc1ccccc1 |
| InChI | InChI=1S/C21H33NO/c1-15(2)20-22(14-17-9-7-6-8-10-17)21(4,5)18-12-11-16(3)13-19(18)23-20/h6-10,15-16,18-20H,11-14H2,1-5H3/t16-,18-,19-,20+/m1/s1 |
| InChIKey | VTMXJOLFVHDHBL-AFYVEPGGSA-N |
| XLogP | 5.08 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.50 |
| LogP ≤ 5 | 5.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |