C32H33NO7 — CID 108708582
propan-2-yl 3-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108708582) has the molecular formula C32H33NO7 and a molecular weight of 543.62 g/mol. Its IUPAC name is propan-2-yl 3-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propan-2-yl 3-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108708582 |
| Molecular Formula | C32H33NO7 |
| Molecular Weight | 543.62 g/mol |
| Exact Mass | 543.23 |
| IUPAC Name | propan-2-yl 3-[(3E)-3-[hydroxy-[3-methyl-4-(2-methylpropoxy)phenyl]methylidene]-2-(4-hydroxyphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | Cc1cc(/C(O)=C2\C(=O)C(=O)N(c3cccc(C(=O)OC(C)C)c3)C2c2ccc(O)cc2)ccc1OCC(C)C |
| InChI | InChI=1S/C32H33NO7/c1-18(2)17-39-26-14-11-22(15-20(26)5)29(35)27-28(21-9-12-25(34)13-10-21)33(31(37)30(27)36)24-8-6-7-23(16-24)32(38)40-19(3)4/h6-16,18-19,28,34-35H,17H2,1-5H3/b29-27+ |
| InChIKey | DKAUQJGMQMUBET-ORIPQNMZSA-N |
| XLogP | 5.93 |
| TPSA | 113.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 543.62 |
| LogP ≤ 5 | 5.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|