C31H25ClN2O6 — CID 108708797
(4E)-1-(4-anilinophenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108708797) has the molecular formula C31H25ClN2O6 and a molecular weight of 557.00 g/mol. Its IUPAC name is (4E)-1-(4-anilinophenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-anilinophenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108708797 |
| Molecular Formula | C31H25ClN2O6 |
| Molecular Weight | 557.00 g/mol |
| Exact Mass | 556.14 |
| IUPAC Name | (4E)-1-(4-anilinophenyl)-4-[(4-chloro-2,5-dimethoxyphenyl)-hydroxymethylidene]-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1cc(/C(O)=C2\C(=O)C(=O)N(c3ccc(Nc4ccccc4)cc3)C2c2ccc(O)cc2)c(OC)cc1Cl |
| InChI | InChI=1S/C31H25ClN2O6/c1-39-25-17-24(32)26(40-2)16-23(25)29(36)27-28(18-8-14-22(35)15-9-18)34(31(38)30(27)37)21-12-10-20(11-13-21)33-19-6-4-3-5-7-19/h3-17,28,33,35-36H,1-2H3/b29-27+ |
| InChIKey | BCTWRVBWFQLAMY-ORIPQNMZSA-N |
| XLogP | 6.43 |
| TPSA | 108.33 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.00 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|