C32H32N2O5S — CID 108709534
(4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108709534) has the molecular formula C32H32N2O5S and a molecular weight of 556.68 g/mol. Its IUPAC name is (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108709534 |
| Molecular Formula | C32H32N2O5S |
| Molecular Weight | 556.68 g/mol |
| Exact Mass | 556.20 |
| IUPAC Name | (4E)-4-[(3-tert-butyl-4-ethoxyphenyl)-hydroxymethylidene]-1-(6-ethyl-1,3-benzothiazol-2-yl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(CC)cc4s3)C2c2ccc(O)cc2)cc1C(C)(C)C |
| InChI | InChI=1S/C32H32N2O5S/c1-6-18-8-14-23-25(16-18)40-31(33-23)34-27(19-9-12-21(35)13-10-19)26(29(37)30(34)38)28(36)20-11-15-24(39-7-2)22(17-20)32(3,4)5/h8-17,27,35-36H,6-7H2,1-5H3/b28-26+ |
| InChIKey | BOIMOXFUHJSPCI-BYCLXTJYSA-N |
| XLogP | 6.89 |
| TPSA | 99.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 556.68 |
| LogP ≤ 5 | 6.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|