C19H30O4 — CID 10870995
(4R,6R)-6-[2-[(1aR,2R,3R,3aR,6R,7aS,7bS)-2,6-dimethyl-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-3-yl]ethyl]-4-hydroxyoxan-2-one (PubChem CID 10870995) has the molecular formula C19H30O4 and a molecular weight of 322.45 g/mol. Its IUPAC name is (4R,6R)-6-[2-[(1aR,2R,3R,3aR,6R,7aS,7bS)-2,6-dimethyl-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-3-yl]ethyl]-4-hydroxyoxan-2-one.
| Compound Name | (4R,6R)-6-[2-[(1aR,2R,3R,3aR,6R,7aS,7bS)-2,6-dimethyl-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-3-yl]ethyl]-4-hydroxyoxan-2-one |
|---|---|
| PubChem CID | 10870995 |
| Molecular Formula | C19H30O4 |
| Molecular Weight | 322.45 g/mol |
| Exact Mass | 322.21 |
| IUPAC Name | (4R,6R)-6-[2-[(1aR,2R,3R,3aR,6R,7aS,7bS)-2,6-dimethyl-1a,2,3,3a,4,5,6,7,7a,7b-decahydronaphtho[1,2-b]oxiren-3-yl]ethyl]-4-hydroxyoxan-2-one |
| SMILES | C[C@@H]1CC[C@@H]2[C@@H](CC[C@@H]3C[C@@H](O)CC(=O)O3)[C@@H](C)[C@H]3O[C@H]3[C@H]2C1 |
| InChI | InChI=1S/C19H30O4/c1-10-3-5-15-14(11(2)18-19(23-18)16(15)7-10)6-4-13-8-12(20)9-17(21)22-13/h10-16,18-20H,3-9H2,1-2H3/t10-,11-,12-,13-,14+,15-,16+,18-,19+/m1/s1 |
| InChIKey | WKEYEBSTVSVDMF-OVUASUNJSA-N |
| XLogP | 2.92 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.45 |
| LogP ≤ 5 | 2.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|