C30H30F2N2O4 — CID 108710056
(4E)-5-[4-(diethylamino)phenyl]-1-(3,4-difluorophenyl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108710056) has the molecular formula C30H30F2N2O4 and a molecular weight of 520.58 g/mol. Its IUPAC name is (4E)-5-[4-(diethylamino)phenyl]-1-(3,4-difluorophenyl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-[4-(diethylamino)phenyl]-1-(3,4-difluorophenyl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108710056 |
| Molecular Formula | C30H30F2N2O4 |
| Molecular Weight | 520.58 g/mol |
| Exact Mass | 520.22 |
| IUPAC Name | (4E)-5-[4-(diethylamino)phenyl]-1-(3,4-difluorophenyl)-4-[hydroxy-(2-methoxy-3,5-dimethylphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(\O)c3cc(C)cc(C)c3OC)C(=O)C(=O)N2c2ccc(F)c(F)c2)cc1 |
| InChI | InChI=1S/C30H30F2N2O4/c1-6-33(7-2)20-10-8-19(9-11-20)26-25(27(35)22-15-17(3)14-18(4)29(22)38-5)28(36)30(37)34(26)21-12-13-23(31)24(32)16-21/h8-16,26,35H,6-7H2,1-5H3/b27-25+ |
| InChIKey | QQEYNEGHOKQUAU-IMVLJIQESA-N |
| XLogP | 6.06 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.58 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|