C17H24O6 — CID 10871040
[(2R,3S,6S)-3-acetyloxy-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate (PubChem CID 10871040) has the molecular formula C17H24O6 and a molecular weight of 324.37 g/mol. Its IUPAC name is [(2R,3S,6S)-3-acetyloxy-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate.
| Compound Name | [(2R,3S,6S)-3-acetyloxy-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
|---|---|
| PubChem CID | 10871040 |
| Molecular Formula | C17H24O6 |
| Molecular Weight | 324.37 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | [(2R,3S,6S)-3-acetyloxy-6-[(3E)-4-methylhexa-3,5-dienoxy]-3,6-dihydro-2H-pyran-2-yl]methyl acetate |
| SMILES | C=C/C(C)=C/CCO[C@@H]1C=C[C@H](OC(C)=O)[C@@H](COC(C)=O)O1 |
| InChI | InChI=1S/C17H24O6/c1-5-12(2)7-6-10-20-17-9-8-15(22-14(4)19)16(23-17)11-21-13(3)18/h5,7-9,15-17H,1,6,10-11H2,2-4H3/b12-7+/t15-,16+,17-/m0/s1 |
| InChIKey | UVYKSXISZSVCMS-YYKBNGSRSA-N |
| XLogP | 2.30 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.37 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|