About 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one
2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one (PubChem CID 10871043) has the molecular formula C18H20N4O2
and a molecular weight of 324.38 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one.
Molecular Properties
| Compound Name | 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one |
| PubChem CID | 10871043 |
| Molecular Formula | C18H20N4O2 |
| Molecular Weight | 324.38 g/mol |
| Exact Mass | 324.16 |
| IUPAC Name | 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one |
| SMILES | O=c1[nH]c2ccc(NCCN3CCOCC3)nc2c2ccccc12 |
| InChI | InChI=1S/C18H20N4O2/c23-18-14-4-2-1-3-13(14)17-15(20-18)5-6-16(21-17)19-7-8-22-9-11-24-12-10-22/h1-6H,7-12H2,(H,19,21)(H,20,23) |
| InChIKey | GSSQKNYFBLSZQD-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 70.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 324.38 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|
Analyze 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one?
The IUPAC name of 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one (CID 10871043) is 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one.
What is the SMILES notation for 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one?
The canonical SMILES for 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one is O=c1[nH]c2ccc(NCCN3CCOCC3)nc2c2ccccc12.
What is the InChIKey of 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one?
The InChIKey is GSSQKNYFBLSZQD-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20N4O2/c23-18-14-4-2-1-3-13(14)17-15(20-18)5-6-16(21-17)19-7-8-22-9-11-24-12-10-22/h1-6H,7-12H2,(H,19,21)(H,20,23).
What are the key properties of 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one?
2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one has a molecular weight of 324.38 g/mol, XLogP of 1.82, 4 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-morpholin-4-ylethylamino)-5H-benzo[c][1,5]naphthyridin-6-one is sourced from PubChem (CID 10871043), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).