C34H40N2O4 — CID 108711002
(4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-dimethylphenyl)pyrrolidine-2,3-dione (PubChem CID 108711002) has the molecular formula C34H40N2O4 and a molecular weight of 540.70 g/mol. Its IUPAC name is (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-dimethylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-dimethylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711002 |
| Molecular Formula | C34H40N2O4 |
| Molecular Weight | 540.70 g/mol |
| Exact Mass | 540.30 |
| IUPAC Name | (4Z)-4-[(3-tert-butyl-4-methoxyphenyl)-hydroxymethylidene]-5-[4-(diethylamino)phenyl]-1-(2,4-dimethylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(/O)c3ccc(OC)c(C(C)(C)C)c3)C(=O)C(=O)N2c2ccc(C)cc2C)cc1 |
| InChI | InChI=1S/C34H40N2O4/c1-9-35(10-2)25-15-12-23(13-16-25)30-29(31(37)24-14-18-28(40-8)26(20-24)34(5,6)7)32(38)33(39)36(30)27-17-11-21(3)19-22(27)4/h11-20,30,37H,9-10H2,1-8H3/b31-29- |
| InChIKey | ZEUOELBFBKADKX-YCNYHXFESA-N |
| XLogP | 7.08 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 540.70 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|