About ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate
ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate (PubChem CID 10871111) has the molecular formula C17H30O4Si
and a molecular weight of 326.51 g/mol. Its IUPAC name is ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate.
Molecular Properties
| Compound Name | ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate |
| PubChem CID | 10871111 |
| Molecular Formula | C17H30O4Si |
| Molecular Weight | 326.51 g/mol |
| Exact Mass | 326.19 |
| IUPAC Name | ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate |
| SMILES | C=C1/C(=C/C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O |
| InChI | InChI=1S/C17H30O4Si/c1-8-20-16(19)10-13-9-14(11-15(18)12(13)2)21-22(6,7)17(3,4)5/h10,14-15,18H,2,8-9,11H2,1,3-7H3/b13-10+/t14-,15+/m1/s1 |
| InChIKey | SAJHSZPKJLTCFH-XGWPRKDGSA-N |
| XLogP | 3.58 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 326.51 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate?
The IUPAC name of ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate (CID 10871111) is ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate.
What is the SMILES notation for ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate?
The canonical SMILES for ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate is C=C1/C(=C/C(=O)OCC)C[C@@H](O[Si](C)(C)C(C)(C)C)C[C@@H]1O.
What is the InChIKey of ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate?
The InChIKey is SAJHSZPKJLTCFH-XGWPRKDGSA-N. The full InChI is InChI=1S/C17H30O4Si/c1-8-20-16(19)10-13-9-14(11-15(18)12(13)2)21-22(6,7)17(3,4)5/h10,14-15,18H,2,8-9,11H2,1,3-7H3/b13-10+/t14-,15+/m1/s1.
What are the key properties of ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate?
ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate has a molecular weight of 326.51 g/mol, XLogP of 3.58, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl (2E)-2-[(3S,5R)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-2-methylidenecyclohexylidene]acetate is sourced from PubChem (CID 10871111), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).