C35H32F2N2O4 — CID 108711149
(4E)-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione (PubChem CID 108711149) has the molecular formula C35H32F2N2O4 and a molecular weight of 582.65 g/mol. Its IUPAC name is (4E)-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione.
| Compound Name | (4E)-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711149 |
| Molecular Formula | C35H32F2N2O4 |
| Molecular Weight | 582.65 g/mol |
| Exact Mass | 582.23 |
| IUPAC Name | (4E)-5-[4-(diethylamino)phenyl]-1-(2,4-difluorophenyl)-4-[hydroxy-(3-methyl-4-phenylmethoxyphenyl)methylidene]pyrrolidine-2,3-dione |
| SMILES | CCN(CC)c1ccc(C2/C(=C(\O)c3ccc(OCc4ccccc4)c(C)c3)C(=O)C(=O)N2c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C35H32F2N2O4/c1-4-38(5-2)27-15-11-24(12-16-27)32-31(34(41)35(42)39(32)29-17-14-26(36)20-28(29)37)33(40)25-13-18-30(22(3)19-25)43-21-23-9-7-6-8-10-23/h6-20,32,40H,4-5,21H2,1-3H3/b33-31+ |
| InChIKey | XSRFJISNXJOFIS-QOSDPKFLSA-N |
| XLogP | 7.32 |
| TPSA | 70.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 582.65 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|