C14H17IO — CID 10871161
(1R,9R,13R)-13-iodo-3,5-dimethyl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene (PubChem CID 10871161) has the molecular formula C14H17IO and a molecular weight of 328.19 g/mol. Its IUPAC name is (1R,9R,13R)-13-iodo-3,5-dimethyl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene.
| Compound Name | (1R,9R,13R)-13-iodo-3,5-dimethyl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
|---|---|
| PubChem CID | 10871161 |
| Molecular Formula | C14H17IO |
| Molecular Weight | 328.19 g/mol |
| Exact Mass | 328.03 |
| IUPAC Name | (1R,9R,13R)-13-iodo-3,5-dimethyl-8-oxatricyclo[7.3.1.02,7]trideca-2,4,6-triene |
| SMILES | Cc1cc(C)c2c(c1)O[C@@H]1CCC[C@H]2[C@H]1I |
| InChI | InChI=1S/C14H17IO/c1-8-6-9(2)13-10-4-3-5-11(14(10)15)16-12(13)7-8/h6-7,10-11,14H,3-5H2,1-2H3/t10-,11-,14-/m1/s1 |
| InChIKey | LCMDPOFCZMRSOT-JTNHKYCSSA-N |
| XLogP | 4.14 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.19 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|