C30H22N2O6 — CID 108711900
(4Z)-4-[hydroxy-(3-nitrophenyl)methylidene]-1-(3-methylphenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108711900) has the molecular formula C30H22N2O6 and a molecular weight of 506.51 g/mol. Its IUPAC name is (4Z)-4-[hydroxy-(3-nitrophenyl)methylidene]-1-(3-methylphenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[hydroxy-(3-nitrophenyl)methylidene]-1-(3-methylphenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108711900 |
| Molecular Formula | C30H22N2O6 |
| Molecular Weight | 506.51 g/mol |
| Exact Mass | 506.15 |
| IUPAC Name | (4Z)-4-[hydroxy-(3-nitrophenyl)methylidene]-1-(3-methylphenyl)-5-(3-phenoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(N2C(=O)C(=O)/C(=C(\O)c3cccc([N+](=O)[O-])c3)C2c2cccc(Oc3ccccc3)c2)c1 |
| InChI | InChI=1S/C30H22N2O6/c1-19-8-5-11-22(16-19)31-27(20-9-7-15-25(18-20)38-24-13-3-2-4-14-24)26(29(34)30(31)35)28(33)21-10-6-12-23(17-21)32(36)37/h2-18,27,33H,1H3/b28-26- |
| InChIKey | MQQYMGVZNZLNHW-SGEDCAFJSA-N |
| XLogP | 6.32 |
| TPSA | 109.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.51 |
| LogP ≤ 5 | 6.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|