About N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide
N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide (PubChem CID 10871279) has the molecular formula C10H9IN2O3
and a molecular weight of 332.10 g/mol. Its IUPAC name is N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide.
Molecular Properties
| Compound Name | N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| PubChem CID | 10871279 |
| Molecular Formula | C10H9IN2O3 |
| Molecular Weight | 332.10 g/mol |
| Exact Mass | 331.97 |
| IUPAC Name | N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide |
| SMILES | O=C(NO)C1COC(c2ccc(I)cc2)=N1 |
| InChI | InChI=1S/C10H9IN2O3/c11-7-3-1-6(2-4-7)10-12-8(5-16-10)9(14)13-15/h1-4,8,15H,5H2,(H,13,14) |
| InChIKey | CSOAULBIGIYEDT-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 332.10 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydroxamic_acid', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide?
The IUPAC name of N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide (CID 10871279) is N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide.
What is the SMILES notation for N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide?
The canonical SMILES for N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide is O=C(NO)C1COC(c2ccc(I)cc2)=N1.
What is the InChIKey of N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide?
The InChIKey is CSOAULBIGIYEDT-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H9IN2O3/c11-7-3-1-6(2-4-7)10-12-8(5-16-10)9(14)13-15/h1-4,8,15H,5H2,(H,13,14).
What are the key properties of N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide?
N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide has a molecular weight of 332.10 g/mol, XLogP of 0.94, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-hydroxy-2-(4-iodophenyl)-4,5-dihydro-1,3-oxazole-4-carboxamide is sourced from PubChem (CID 10871279), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).