C30H29NO6 — CID 108712996
(4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-methylphenyl)-1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyrrolidine-2,3-dione (PubChem CID 108712996) has the molecular formula C30H29NO6 and a molecular weight of 499.56 g/mol. Its IUPAC name is (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-methylphenyl)-1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-methylphenyl)-1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108712996 |
| Molecular Formula | C30H29NO6 |
| Molecular Weight | 499.56 g/mol |
| Exact Mass | 499.20 |
| IUPAC Name | (4Z)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-5-(3-methylphenyl)-1-[[4-[(2-methylpropan-2-yl)oxy]phenyl]methyl]pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(C2/C(=C(/O)c3ccc4c(c3)OCO4)C(=O)C(=O)N2Cc2ccc(OC(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C30H29NO6/c1-18-6-5-7-20(14-18)26-25(27(32)21-10-13-23-24(15-21)36-17-35-23)28(33)29(34)31(26)16-19-8-11-22(12-9-19)37-30(2,3)4/h5-15,26,32H,16-17H2,1-4H3/b27-25- |
| InChIKey | CHKOWZPIUCGQNL-RFBIWTDZSA-N |
| XLogP | 5.52 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.56 |
| LogP ≤ 5 | 5.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|