C29H27NO6 — CID 108713865
propan-2-yl 4-[(3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108713865) has the molecular formula C29H27NO6 and a molecular weight of 485.54 g/mol. Its IUPAC name is propan-2-yl 4-[(3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | propan-2-yl 4-[(3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108713865 |
| Molecular Formula | C29H27NO6 |
| Molecular Weight | 485.54 g/mol |
| Exact Mass | 485.18 |
| IUPAC Name | propan-2-yl 4-[(3E)-3-[hydroxy-(4-methoxyphenyl)methylidene]-2-(3-methylphenyl)-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | COc1ccc(/C(O)=C2\C(=O)C(=O)N(c3ccc(C(=O)OC(C)C)cc3)C2c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C29H27NO6/c1-17(2)36-29(34)20-8-12-22(13-9-20)30-25(21-7-5-6-18(3)16-21)24(27(32)28(30)33)26(31)19-10-14-23(35-4)15-11-19/h5-17,25,31H,1-4H3/b26-24+ |
| InChIKey | ZQRIPTCGVBMTQK-SHHOIMCASA-N |
| XLogP | 5.20 |
| TPSA | 93.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 485.54 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|