C32H27ClN2O4 — CID 108714167
(4E)-1-(4-anilinophenyl)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714167) has the molecular formula C32H27ClN2O4 and a molecular weight of 539.03 g/mol. Its IUPAC name is (4E)-1-(4-anilinophenyl)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(4-anilinophenyl)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714167 |
| Molecular Formula | C32H27ClN2O4 |
| Molecular Weight | 539.03 g/mol |
| Exact Mass | 538.17 |
| IUPAC Name | (4E)-1-(4-anilinophenyl)-4-[(2-chloro-5-ethoxyphenyl)-hydroxymethylidene]-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(Cl)c(/C(O)=C2\C(=O)C(=O)N(c3ccc(Nc4ccccc4)cc3)C2c2cccc(C)c2)c1 |
| InChI | InChI=1S/C32H27ClN2O4/c1-3-39-25-16-17-27(33)26(19-25)30(36)28-29(21-9-7-8-20(2)18-21)35(32(38)31(28)37)24-14-12-23(13-15-24)34-22-10-5-4-6-11-22/h4-19,29,34,36H,3H2,1-2H3/b30-28+ |
| InChIKey | UTGXWTDLYDVWNA-SJCQXOIGSA-N |
| XLogP | 7.42 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.03 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|