C19H32O3Si — CID 10871418
(1R,2S)-1-[(3aS,7aS)-3a,5,5-trimethyl-3-methylidene-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-4-trimethylsilylbut-3-yne-1,2-diol (PubChem CID 10871418) has the molecular formula C19H32O3Si and a molecular weight of 336.55 g/mol. Its IUPAC name is (1R,2S)-1-[(3aS,7aS)-3a,5,5-trimethyl-3-methylidene-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-4-trimethylsilylbut-3-yne-1,2-diol.
| Compound Name | (1R,2S)-1-[(3aS,7aS)-3a,5,5-trimethyl-3-methylidene-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-4-trimethylsilylbut-3-yne-1,2-diol |
|---|---|
| PubChem CID | 10871418 |
| Molecular Formula | C19H32O3Si |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.21 |
| IUPAC Name | (1R,2S)-1-[(3aS,7aS)-3a,5,5-trimethyl-3-methylidene-4,6,7,7a-tetrahydro-1-benzofuran-4-yl]-4-trimethylsilylbut-3-yne-1,2-diol |
| SMILES | C=C1CO[C@H]2CCC(C)(C)C([C@@H](O)[C@@H](O)C#C[Si](C)(C)C)[C@@]12C |
| InChI | InChI=1S/C19H32O3Si/c1-13-12-22-15-8-10-18(2,3)17(19(13,15)4)16(21)14(20)9-11-23(5,6)7/h14-17,20-21H,1,8,10,12H2,2-7H3/t14-,15-,16-,17?,19-/m0/s1 |
| InChIKey | HXVIQNUXSUGXFV-PAZSAERASA-N |
| XLogP | 2.99 |
| TPSA | 49.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|