C22H28OSi — CID 10871421
tert-butyl-dimethyl-[[(8Z)-2-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,8,10(14),11,15-heptaenyl]oxy]silane (PubChem CID 10871421) has the molecular formula C22H28OSi and a molecular weight of 336.55 g/mol. Its IUPAC name is tert-butyl-dimethyl-[[(8Z)-2-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,8,10(14),11,15-heptaenyl]oxy]silane.
| Compound Name | tert-butyl-dimethyl-[[(8Z)-2-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,8,10(14),11,15-heptaenyl]oxy]silane |
|---|---|
| PubChem CID | 10871421 |
| Molecular Formula | C22H28OSi |
| Molecular Weight | 336.55 g/mol |
| Exact Mass | 336.19 |
| IUPAC Name | tert-butyl-dimethyl-[[(8Z)-2-tricyclo[8.2.2.24,7]hexadeca-1(13),4,6,8,10(14),11,15-heptaenyl]oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)OC1Cc2ccc(cc2)/C=C\c2ccc1cc2 |
| InChI | InChI=1S/C22H28OSi/c1-22(2,3)24(4,5)23-21-16-19-10-8-17(9-11-19)6-7-18-12-14-20(21)15-13-18/h6-15,21H,16H2,1-5H3/b7-6- |
| InChIKey | GUAPAEVODHGGJV-SREVYHEPSA-N |
| XLogP | 6.48 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 336.55 |
| LogP ≤ 5 | 6.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|