C27H21ClN2O5S — CID 108714769
(4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108714769) has the molecular formula C27H21ClN2O5S and a molecular weight of 520.99 g/mol. Its IUPAC name is (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108714769 |
| Molecular Formula | C27H21ClN2O5S |
| Molecular Weight | 520.99 g/mol |
| Exact Mass | 520.09 |
| IUPAC Name | (4E)-4-[(4-chloro-3-methoxyphenyl)-hydroxymethylidene]-1-(6-methoxy-1,3-benzothiazol-2-yl)-5-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc(Cl)c(OC)c4)C3c3cccc(C)c3)sc2c1 |
| InChI | InChI=1S/C27H21ClN2O5S/c1-14-5-4-6-15(11-14)23-22(24(31)16-7-9-18(28)20(12-16)35-3)25(32)26(33)30(23)27-29-19-10-8-17(34-2)13-21(19)36-27/h4-13,23,31H,1-3H3/b24-22+ |
| InChIKey | FANUICBFDCNZDH-ZNTNEXAZSA-N |
| XLogP | 5.90 |
| TPSA | 88.96 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.99 |
| LogP ≤ 5 | 5.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|