C21H28O2Si — CID 10871547
(2S,3S,4R,5R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-5-phenyloxan-4-ol (PubChem CID 10871547) has the molecular formula C21H28O2Si and a molecular weight of 340.54 g/mol. Its IUPAC name is (2S,3S,4R,5R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-5-phenyloxan-4-ol.
| Compound Name | (2S,3S,4R,5R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-5-phenyloxan-4-ol |
|---|---|
| PubChem CID | 10871547 |
| Molecular Formula | C21H28O2Si |
| Molecular Weight | 340.54 g/mol |
| Exact Mass | 340.19 |
| IUPAC Name | (2S,3S,4R,5R)-2-[[dimethyl(phenyl)silyl]methyl]-3-methyl-5-phenyloxan-4-ol |
| SMILES | C[C@H]1[C@H](O)[C@H](c2ccccc2)CO[C@@H]1C[Si](C)(C)c1ccccc1 |
| InChI | InChI=1S/C21H28O2Si/c1-16-20(15-24(2,3)18-12-8-5-9-13-18)23-14-19(21(16)22)17-10-6-4-7-11-17/h4-13,16,19-22H,14-15H2,1-3H3/t16-,19+,20-,21+/m1/s1 |
| InChIKey | ZNNJQSXOLMRISJ-RCOXNQKVSA-N |
| XLogP | 3.78 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.54 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|