C17H30O5Si — CID 10871614
ethyl (2Z,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-oxonona-2,7-dienoate (PubChem CID 10871614) has the molecular formula C17H30O5Si and a molecular weight of 342.51 g/mol. Its IUPAC name is ethyl (2Z,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-oxonona-2,7-dienoate.
| Compound Name | ethyl (2Z,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-oxonona-2,7-dienoate |
|---|---|
| PubChem CID | 10871614 |
| Molecular Formula | C17H30O5Si |
| Molecular Weight | 342.51 g/mol |
| Exact Mass | 342.19 |
| IUPAC Name | ethyl (2Z,7Z)-9-[tert-butyl(dimethyl)silyl]oxy-2-hydroxy-4-oxonona-2,7-dienoate |
| SMILES | CCOC(=O)/C(O)=C/C(=O)CC/C=C\CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H30O5Si/c1-7-21-16(20)15(19)13-14(18)11-9-8-10-12-22-23(5,6)17(2,3)4/h8,10,13,19H,7,9,11-12H2,1-6H3/b10-8-,15-13- |
| InChIKey | KPRGXCUXBPYWCX-RYCDELOBSA-N |
| XLogP | 3.92 |
| TPSA | 72.83 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.51 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|