C20H26O3S — CID 10871706
methyl (Z,6S)-7-methyl-3-oxo-9-phenylsulfanyl-6-prop-1-en-2-ylnon-7-enoate (PubChem CID 10871706) has the molecular formula C20H26O3S and a molecular weight of 346.49 g/mol. Its IUPAC name is methyl (Z,6S)-7-methyl-3-oxo-9-phenylsulfanyl-6-prop-1-en-2-ylnon-7-enoate.
| Compound Name | methyl (Z,6S)-7-methyl-3-oxo-9-phenylsulfanyl-6-prop-1-en-2-ylnon-7-enoate |
|---|---|
| PubChem CID | 10871706 |
| Molecular Formula | C20H26O3S |
| Molecular Weight | 346.49 g/mol |
| Exact Mass | 346.16 |
| IUPAC Name | methyl (Z,6S)-7-methyl-3-oxo-9-phenylsulfanyl-6-prop-1-en-2-ylnon-7-enoate |
| SMILES | C=C(C)[C@H](CCC(=O)CC(=O)OC)/C(C)=C\CSc1ccccc1 |
| InChI | InChI=1S/C20H26O3S/c1-15(2)19(11-10-17(21)14-20(22)23-4)16(3)12-13-24-18-8-6-5-7-9-18/h5-9,12,19H,1,10-11,13-14H2,2-4H3/b16-12-/t19-/m0/s1 |
| InChIKey | HJYXFLOGBIZPRH-UIRWJGRMSA-N |
| XLogP | 4.83 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.49 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|