C35H41NO4 — CID 108717089
(4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108717089) has the molecular formula C35H41NO4 and a molecular weight of 539.72 g/mol. Its IUPAC name is (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108717089 |
| Molecular Formula | C35H41NO4 |
| Molecular Weight | 539.72 g/mol |
| Exact Mass | 539.30 |
| IUPAC Name | (4E)-4-[(5-tert-butyl-2-methylphenyl)-hydroxymethylidene]-5-(4-tert-butylphenyl)-1-(3-propoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCCOc1cccc(N2C(=O)C(=O)/C(=C(/O)c3cc(C(C)(C)C)ccc3C)C2c2ccc(C(C)(C)C)cc2)c1 |
| InChI | InChI=1S/C35H41NO4/c1-9-19-40-27-12-10-11-26(21-27)36-30(23-14-17-24(18-15-23)34(3,4)5)29(32(38)33(36)39)31(37)28-20-25(35(6,7)8)16-13-22(28)2/h10-18,20-21,30,37H,9,19H2,1-8H3/b31-29+ |
| InChIKey | WDCXTNXANXJGJY-OWWNRXNESA-N |
| XLogP | 8.01 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.72 |
| LogP ≤ 5 | 8.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|