C16H31BrOSi — CID 10871738
[(2E,5R,8E)-2-bromodeca-2,8-dien-5-yl]oxy-triethylsilane (PubChem CID 10871738) has the molecular formula C16H31BrOSi and a molecular weight of 347.41 g/mol. Its IUPAC name is [(2E,5R,8E)-2-bromodeca-2,8-dien-5-yl]oxy-triethylsilane.
| Compound Name | [(2E,5R,8E)-2-bromodeca-2,8-dien-5-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 10871738 |
| Molecular Formula | C16H31BrOSi |
| Molecular Weight | 347.41 g/mol |
| Exact Mass | 346.13 |
| IUPAC Name | [(2E,5R,8E)-2-bromodeca-2,8-dien-5-yl]oxy-triethylsilane |
| SMILES | C/C=C/CC[C@H](C/C=C(\C)Br)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C16H31BrOSi/c1-6-10-11-12-16(14-13-15(5)17)18-19(7-2,8-3)9-4/h6,10,13,16H,7-9,11-12,14H2,1-5H3/b10-6+,15-13+/t16-/m1/s1 |
| InChIKey | JBBNTONQRYOVEV-VKPLJOKXSA-N |
| XLogP | 6.42 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.41 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|