C36H43NO4 — CID 108717465
(4Z)-1,5-bis(4-tert-butylphenyl)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione (PubChem CID 108717465) has the molecular formula C36H43NO4 and a molecular weight of 553.74 g/mol. Its IUPAC name is (4Z)-1,5-bis(4-tert-butylphenyl)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione.
| Compound Name | (4Z)-1,5-bis(4-tert-butylphenyl)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108717465 |
| Molecular Formula | C36H43NO4 |
| Molecular Weight | 553.74 g/mol |
| Exact Mass | 553.32 |
| IUPAC Name | (4Z)-1,5-bis(4-tert-butylphenyl)-4-[(4-ethoxy-3-propan-2-ylphenyl)-hydroxymethylidene]pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C(C)(C)C)cc3)C2c2ccc(C(C)(C)C)cc2)cc1C(C)C |
| InChI | InChI=1S/C36H43NO4/c1-10-41-29-20-13-24(21-28(29)22(2)3)32(38)30-31(23-11-14-25(15-12-23)35(4,5)6)37(34(40)33(30)39)27-18-16-26(17-19-27)36(7,8)9/h11-22,31,38H,10H2,1-9H3/b32-30- |
| InChIKey | GVHNIJFJEGOFQT-GCUVURNUSA-N |
| XLogP | 8.43 |
| TPSA | 66.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 553.74 |
| LogP ≤ 5 | 8.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|