C20H32N2O3 — CID 10871765
(1R,5S)-N-[(1R)-1-cyclohexylethyl]-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide (PubChem CID 10871765) has the molecular formula C20H32N2O3 and a molecular weight of 348.49 g/mol. Its IUPAC name is (1R,5S)-N-[(1R)-1-cyclohexylethyl]-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide.
| Compound Name | (1R,5S)-N-[(1R)-1-cyclohexylethyl]-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
|---|---|
| PubChem CID | 10871765 |
| Molecular Formula | C20H32N2O3 |
| Molecular Weight | 348.49 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | (1R,5S)-N-[(1R)-1-cyclohexylethyl]-1,5,7-trimethyl-2,4-dioxo-3-azabicyclo[3.3.1]nonane-7-carboxamide |
| SMILES | C[C@@H](NC(=O)C1(C)C[C@@]2(C)C[C@@](C)(C1)C(=O)NC2=O)C1CCCCC1 |
| InChI | InChI=1S/C20H32N2O3/c1-13(14-8-6-5-7-9-14)21-15(23)18(2)10-19(3)12-20(4,11-18)17(25)22-16(19)24/h13-14H,5-12H2,1-4H3,(H,21,23)(H,22,24,25)/t13-,18?,19-,20+/m1/s1 |
| InChIKey | CVFWUEDDXLVQRZ-CIXBDGESSA-N |
| XLogP | 2.93 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.49 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|