C33H35NO7 — CID 108717837
methyl 4-[(3Z)-2-(4-tert-butylphenyl)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate (PubChem CID 108717837) has the molecular formula C33H35NO7 and a molecular weight of 557.64 g/mol. Its IUPAC name is methyl 4-[(3Z)-2-(4-tert-butylphenyl)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate.
| Compound Name | methyl 4-[(3Z)-2-(4-tert-butylphenyl)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
|---|---|
| PubChem CID | 108717837 |
| Molecular Formula | C33H35NO7 |
| Molecular Weight | 557.64 g/mol |
| Exact Mass | 557.24 |
| IUPAC Name | methyl 4-[(3Z)-2-(4-tert-butylphenyl)-3-[(2,4-diethoxyphenyl)-hydroxymethylidene]-4,5-dioxopyrrolidin-1-yl]benzoate |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3ccc(C(=O)OC)cc3)C2c2ccc(C(C)(C)C)cc2)c(OCC)c1 |
| InChI | InChI=1S/C33H35NO7/c1-7-40-24-17-18-25(26(19-24)41-8-2)29(35)27-28(20-9-13-22(14-10-20)33(3,4)5)34(31(37)30(27)36)23-15-11-21(12-16-23)32(38)39-6/h9-19,28,35H,7-8H2,1-6H3/b29-27- |
| InChIKey | WNTAXIYMQVGSNU-OHYPFYFLSA-N |
| XLogP | 6.19 |
| TPSA | 102.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.64 |
| LogP ≤ 5 | 6.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|