C15H21F3N2O4 — CID 10871812
(1S,4Z,8R)-8-[[2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]cyclooct-4-ene-1-carboxylic acid (PubChem CID 10871812) has the molecular formula C15H21F3N2O4 and a molecular weight of 350.34 g/mol. Its IUPAC name is (1S,4Z,8R)-8-[[2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]cyclooct-4-ene-1-carboxylic acid.
| Compound Name | (1S,4Z,8R)-8-[[2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]cyclooct-4-ene-1-carboxylic acid |
|---|---|
| PubChem CID | 10871812 |
| Molecular Formula | C15H21F3N2O4 |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | (1S,4Z,8R)-8-[[2-methyl-2-[(2,2,2-trifluoroacetyl)amino]propanoyl]amino]cyclooct-4-ene-1-carboxylic acid |
| SMILES | CC(C)(NC(=O)C(F)(F)F)C(=O)N[C@@H]1CC/C=C\CC[C@@H]1C(=O)O |
| InChI | InChI=1S/C15H21F3N2O4/c1-14(2,20-13(24)15(16,17)18)12(23)19-10-8-6-4-3-5-7-9(10)11(21)22/h3-4,9-10H,5-8H2,1-2H3,(H,19,23)(H,20,24)(H,21,22)/b4-3-/t9-,10+/m0/s1 |
| InChIKey | GJNRIULWZQEUFX-RWCMCFKCSA-N |
| XLogP | 1.76 |
| TPSA | 95.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|