About [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate
[3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate (PubChem CID 10871831) has the molecular formula C19H26N2O2
and a molecular weight of 314.43 g/mol. Its IUPAC name is [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate.
Molecular Properties
| Compound Name | [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate |
| PubChem CID | 10871831 |
| Molecular Formula | C19H26N2O2 |
| Molecular Weight | 314.43 g/mol |
| Exact Mass | 314.20 |
| IUPAC Name | [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate |
| SMILES | C#CCNC1CCc2ccc(OC(=O)N(CC)CCCC)cc21 |
| InChI | InChI=1S/C19H26N2O2/c1-4-7-13-21(6-3)19(22)23-16-10-8-15-9-11-18(17(15)14-16)20-12-5-2/h2,8,10,14,18,20H,4,6-7,9,11-13H2,1,3H3 |
| InChIKey | BEARQABAQRNDEO-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.43 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate?
The IUPAC name of [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate (CID 10871831) is [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate.
What is the SMILES notation for [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate?
The canonical SMILES for [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate is C#CCNC1CCc2ccc(OC(=O)N(CC)CCCC)cc21.
What is the InChIKey of [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate?
The InChIKey is BEARQABAQRNDEO-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H26N2O2/c1-4-7-13-21(6-3)19(22)23-16-10-8-15-9-11-18(17(15)14-16)20-12-5-2/h2,8,10,14,18,20H,4,6-7,9,11-13H2,1,3H3.
What are the key properties of [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate?
[3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate has a molecular weight of 314.43 g/mol, XLogP of 3.52, 7 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [3-(prop-2-ynylamino)-2,3-dihydro-1H-inden-5-yl] N-butyl-N-ethylcarbamate is sourced from PubChem (CID 10871831), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).