C20H35NO3Si — CID 10872244
(1R,2S,2'S,5R,5'R,8S,9S)-5'-methyl-2'-propan-2-yl-9-trimethylsilylspiro[4,7-dioxa-6-azatricyclo[6.3.0.02,6]undecane-5,1'-cyclohexane]-3-one (PubChem CID 10872244) has the molecular formula C20H35NO3Si and a molecular weight of 365.59 g/mol. Its IUPAC name is (1R,2S,2'S,5R,5'R,8S,9S)-5'-methyl-2'-propan-2-yl-9-trimethylsilylspiro[4,7-dioxa-6-azatricyclo[6.3.0.02,6]undecane-5,1'-cyclohexane]-3-one.
| Compound Name | (1R,2S,2'S,5R,5'R,8S,9S)-5'-methyl-2'-propan-2-yl-9-trimethylsilylspiro[4,7-dioxa-6-azatricyclo[6.3.0.02,6]undecane-5,1'-cyclohexane]-3-one |
|---|---|
| PubChem CID | 10872244 |
| Molecular Formula | C20H35NO3Si |
| Molecular Weight | 365.59 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (1R,2S,2'S,5R,5'R,8S,9S)-5'-methyl-2'-propan-2-yl-9-trimethylsilylspiro[4,7-dioxa-6-azatricyclo[6.3.0.02,6]undecane-5,1'-cyclohexane]-3-one |
| SMILES | CC(C)[C@@H]1CC[C@@H](C)C[C@@]12OC(=O)[C@@H]1[C@H]3CC[C@H]([Si](C)(C)C)[C@H]3ON12 |
| InChI | InChI=1S/C20H35NO3Si/c1-12(2)15-9-7-13(3)11-20(15)21-17(19(22)23-20)14-8-10-16(18(14)24-21)25(4,5)6/h12-18H,7-11H2,1-6H3/t13-,14-,15+,16+,17+,18+,20-/m1/s1 |
| InChIKey | WERPARMHYSOWHU-LLGVVZMMSA-N |
| XLogP | 4.43 |
| TPSA | 38.77 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.59 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|