C30H29N3O4S — CID 108723528
(4E)-1-(6-tert-butyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione (PubChem CID 108723528) has the molecular formula C30H29N3O4S and a molecular weight of 527.65 g/mol. Its IUPAC name is (4E)-1-(6-tert-butyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-1-(6-tert-butyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723528 |
| Molecular Formula | C30H29N3O4S |
| Molecular Weight | 527.65 g/mol |
| Exact Mass | 527.19 |
| IUPAC Name | (4E)-1-(6-tert-butyl-1,3-benzothiazol-2-yl)-4-[hydroxy-(3-propan-2-yloxyphenyl)methylidene]-5-pyridin-2-ylpyrrolidine-2,3-dione |
| SMILES | CC(C)Oc1cccc(/C(O)=C2\C(=O)C(=O)N(c3nc4ccc(C(C)(C)C)cc4s3)C2c2ccccn2)c1 |
| InChI | InChI=1S/C30H29N3O4S/c1-17(2)37-20-10-8-9-18(15-20)26(34)24-25(22-11-6-7-14-31-22)33(28(36)27(24)35)29-32-21-13-12-19(30(3,4)5)16-23(21)38-29/h6-17,25,34H,1-5H3/b26-24+ |
| InChIKey | WLDVZPCBZOHQPK-SHHOIMCASA-N |
| XLogP | 6.40 |
| TPSA | 92.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 527.65 |
| LogP ≤ 5 | 6.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|