C27H25ClN4O3 — CID 108723982
(4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108723982) has the molecular formula C27H25ClN4O3 and a molecular weight of 488.98 g/mol. Its IUPAC name is (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108723982 |
| Molecular Formula | C27H25ClN4O3 |
| Molecular Weight | 488.98 g/mol |
| Exact Mass | 488.16 |
| IUPAC Name | (4E)-4-[(3-chlorophenyl)-hydroxymethylidene]-1-[4-(4-methylpiperazin-1-yl)phenyl]-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | CN1CCN(c2ccc(N3C(=O)C(=O)/C(=C(/O)c4cccc(Cl)c4)C3c3cccnc3)cc2)CC1 |
| InChI | InChI=1S/C27H25ClN4O3/c1-30-12-14-31(15-13-30)21-7-9-22(10-8-21)32-24(19-5-3-11-29-17-19)23(26(34)27(32)35)25(33)18-4-2-6-20(28)16-18/h2-11,16-17,24,33H,12-15H2,1H3/b25-23+ |
| InChIKey | ADBGFWRPGAFRCI-WJTDDFOZSA-N |
| XLogP | 4.11 |
| TPSA | 76.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 488.98 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|