C26H20N4O7 — CID 108725031
(4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione (PubChem CID 108725031) has the molecular formula C26H20N4O7 and a molecular weight of 500.47 g/mol. Its IUPAC name is (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108725031 |
| Molecular Formula | C26H20N4O7 |
| Molecular Weight | 500.47 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | (4E)-4-[1,3-benzodioxol-5-yl(hydroxy)methylidene]-1-(5,6-dimethoxy-1H-benzimidazol-2-yl)-5-pyridin-3-ylpyrrolidine-2,3-dione |
| SMILES | COc1cc2nc(N3C(=O)C(=O)/C(=C(/O)c4ccc5c(c4)OCO5)C3c3cccnc3)[nH]c2cc1OC |
| InChI | InChI=1S/C26H20N4O7/c1-34-18-9-15-16(10-19(18)35-2)29-26(28-15)30-22(14-4-3-7-27-11-14)21(24(32)25(30)33)23(31)13-5-6-17-20(8-13)37-12-36-17/h3-11,22,31H,12H2,1-2H3,(H,28,29)/b23-21+ |
| InChIKey | LQXBQWJBVRGTTB-XTQSDGFTSA-N |
| XLogP | 3.33 |
| TPSA | 136.10 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.47 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|