C24H18ClN3O3 — CID 108726065
3-[(E)-3-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-3-oxoprop-1-enyl]chromen-4-one (PubChem CID 108726065) has the molecular formula C24H18ClN3O3 and a molecular weight of 431.88 g/mol. Its IUPAC name is 3-[(E)-3-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-3-oxoprop-1-enyl]chromen-4-one.
| Compound Name | 3-[(E)-3-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-3-oxoprop-1-enyl]chromen-4-one |
|---|---|
| PubChem CID | 108726065 |
| Molecular Formula | C24H18ClN3O3 |
| Molecular Weight | 431.88 g/mol |
| Exact Mass | 431.10 |
| IUPAC Name | 3-[(E)-3-[3-(4-chlorophenyl)-1,4,6,7-tetrahydropyrazolo[4,3-c]pyridin-5-yl]-3-oxoprop-1-enyl]chromen-4-one |
| SMILES | O=C(/C=C/c1coc2ccccc2c1=O)N1CCc2[nH]nc(-c3ccc(Cl)cc3)c2C1 |
| InChI | InChI=1S/C24H18ClN3O3/c25-17-8-5-15(6-9-17)23-19-13-28(12-11-20(19)26-27-23)22(29)10-7-16-14-31-21-4-2-1-3-18(21)24(16)30/h1-10,14H,11-13H2,(H,26,27)/b10-7+ |
| InChIKey | OITKOZOPXNHOSR-JXMROGBWSA-N |
| XLogP | 4.43 |
| TPSA | 79.20 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.88 |
| LogP ≤ 5 | 4.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|